Leucettine L41
Potent inhibitor of DYRKs and CLKs. Interacts also with GSK-3alpha/beta, CK2 and PIM1. Interacts with the complex PIKfyve/Vac14/Fig4. Modulates alternative splicing of pre-mRNA in various cellular systems. Neuroprotective against APP-induced cell death. Tools to study and modulate pre-RNA splicing. Potential compound for Alzheimer’s disease and diseases involving abnormal pre-mRNA splicing. Potential compound to study Down syndrome (inhibition of DYRK1A). Neuroprotective against glutamate-induced cell death. Autophagy activator.
| Catalog Number | AG-MR-C0023-M005 |
| Alternative Name(s) | (5Z)-5-(1,3-Benzodioxol-5-yl)methylene-2-phenylamino-3,5-dihydro-4H-imidazol-4one |
| Research Area | Autophagy, Biochemicals, Inflammation, Neurobiology, Neurodegenerative Disease |
| Molecular Formula | C17H13N3O3 |
| CAS# | 1112978-84-3 |
| Purity | >98% |
| Inchi | InChI=1S/C17H13N3O3/c21-16-13(8-11-6-7-14-15(9-11)23-10-22-14)19-17(20-16)18-12-4-2-1-3-5-12/h1-9H,10H2,(H2,18,19,20,21)/b13-8- |
| Inchi Key | PGPHHJBZEGSUNE-JYRVWZFOSA-N |
| SMILES | O=C1NC(NC2=CC=CC=C2)=NC1=C/C1=CC2=C(OCO2)C=C1 |
| Size | 5 mg |
| Supplier Page | http://www.adipogen.com/mr-c0023/leucettine-l41.html |
