(S)-Perharidine 1
Potent and selective inhibitor of cyclin dependent kinases CDK1, CDK2, CDK5 and CDK9. Apoptosis inducer. Inhibits the proliferation of various cancer cell lines. Casein kinase 1 (CK1delta/epsilon) and DYRK1A inhibitor. Potential anti-inflammatory compound. Potential antidiabetic compound.
| Catalog Number | AG-MR-C0012-M005 |
| Research Area | Apoptosis, Biochemicals, Cancer, Cell Death, Inflammation, Metabolism |
| Molecular Formula | C25H30N6O |
| CAS# | 1133437-81-6 |
| Purity | >95% |
| Inchi | InChI=1S/C25H30N6O/c1-4-20(15-32)29-23-13-22(24-25(30-23)31(16-28-24)17(2)3)27-14-18-8-10-19(11-9-18)21-7-5-6-12-26-21/h5-13,16-17,20,32H,4,14-15H2,1-3H3,(H2,27,29,30)/t20-/m0/s1 |
| Inchi Key | VGHHVXRBOQENRA-FQEVSTJZSA-N |
| SMILES | CC[C@@H](CO)NC1=NC2=C(N=CN2C(C)C)C(NCC2=CC=C(C=C2)C2=NC=CC=C2)=C1 |
| Size | 5 mg |
| Supplier Page | http://www.adipogen.com/mr-c0012/-s-perharidine-1.html |
