CK2 Inhibitor 10
Potent and ATP-competitive inhibitor of casein kinase 2 (IC50 CK2alpha=32nM and IC50 CK2alpha’=46nM). Potently also inhibits DYRK1B and FLT3. Anticancer compound. Exhibits potent cytotoxicity towards lung cancer cells A549, colorectal cancer cells HCT-116 and breast cancer cells MCF-7. Promoted cAMP-induced thermogenesis in white adipocytes. CK2 inhibition ameliorates diet-induced obesity and insulin resistance in mice in vivo by promoting UCP1-dependent thermogenesis.
| Catalog Number | AG-CR1-3626-M001 |
| Alternative Name(s) | CK2-VIII; 4-(2-(4-Methoxybenzamido)thiazol-5-yl)benzoic acid |
| Research Area | Biochemicals, Cancer, Obesity |
| Molecular Formula | C18H14N2O4S . 0.5H2O |
| CAS# | 1361229-76-6 |
| Purity | >98% |
| Inchi | InChI=1S/C18H14N2O4S/c1-24-14-8-6-12(7-9-14)16(21)20-18-19-10-15(25-18)11-2-4-13(5-3-11)17(22)23/h2-10H,1H3,(H,22,23)(H,19,20,21) |
| Inchi Key | UPIVZLFKYMNZDG-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)NC1=NC=C(S1)C1=CC=C(C=C1)C(O)=O |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-3626/ck2-inhibitor-10.html |
