(S)-3-Hydroxybutyric acid
Physiologically insignificant stereoisomer of (R)-3-Hydroxybutyric acid, a key metabolite of the ketolytic pathway. Anticonvulsant. Endogenous inhibitor of histone deacetylases (HDACs) 1, 3 and 4. Ligand of free fatty acid receptor 3 (FFAR3; GPR41) and hydroxycarboxylic acid receptor 2 (HCAR2; GPR109B). NLRP3 inflammasome inhibitor. Prevents K+-efflux and reduces ASC oligomerization and speck formation.
| Catalog Number | AG-CR1-3617-M025 |
| Alternative Name(s) | (S)-beta-Hydroxybutyric acid; L-(+)-3-Hydroxybutyric acid; L-(+)-BHB |
| Research Area | Biochemicals, Inflammasomes, Inflammation, Metabolism |
| Molecular Formula | C4H8O3 |
| CAS# | 6168-83-8 |
| Purity | >98% |
| Inchi | InChI=1S/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m0/s1 |
| Inchi Key | WHBMMWSBFZVSSR-VKHMYHEASA-N |
| SMILES | C[C@H](O)CC(O)=O |
| Size | 25 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-3617/-s-3-hydroxybutyric-acid.html |
