(R)-3-Hydroxybutyric acid
Key metabolite of the ketolytic pathway generating acetyl-CoA. Stereoselective product of D-3-hydroxybutyrate dehydreogenase. Clinically and physiologically significant stereoisomer. Energy carrier from adipocytes to peripheral tissues during fasting or exercise. Endogenous inhibitor of histone deacetylases (HDACs) 1, 3 and 4. Ligand of free fatty acid receptor 3 (FFAR3; GPR41) and hydroxycarboxylic acid receptor 2 (HCAR2; GPR109B). NLRP3 inflammasome inhibitor. Prevents K+-efflux and reduces ASC oligomerization and speck formation.
| Catalog Number | AG-CR1-3616-M025 |
| Alternative Name(s) | (R)-beta-Hydroxybutyric acid; D-(-)-3-Hydroxybutyric acid; D-(-)-BHB |
| Research Area | Biochemicals, Inflammasomes, Inflammation, Metabolism |
| Molecular Formula | C4H8O3 |
| CAS# | 625-72-9 |
| Purity | >98% |
| Inchi | InChI=1S/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m1/s1 |
| Inchi Key | WHBMMWSBFZVSSR-GSVOUGTGSA-N |
| SMILES | C[C@@H](O)CC(O)=O |
| Size | 25 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-3616/-r-3-hydroxybutyric-acid.html |
