cGAMP . 2Na [STING Ligand]
Potent STING ligand. Second messenger in human and mouse cells that triggers interferon production in response to cytosolic DNA. Binding to STING leads to activation of IRF3 (IFN regulatory factor 3) and the induction of interferon-beta. First cyclic nucleotide in metazoa. Plays a role in bacterial chemotaxis and colonization.
| Catalog Number | AG-CR1-3588-C500 |
| Alternative Name(s) | cyclic (adenosine monophosphate-guanosine monophosphate); cyclic GMP-AMP; c-(GpAp); 3',3'-cGAMP |
| Research Area | Biochemicals, Immunology, Inflammation |
| Molecular Formula | C20H24N10O13P2 . 2Na |
| CAS# | 849214-04-6 (free acid) |
| Purity | >98% |
| Inchi | InChI=1S/C20H24N10O13P2.2Na/c21-14-8-15(24-3-23-14)29(4-25-8)18-10(31)12-6(40-18)1-38-45(36,37)43-13-7(2-39-44(34,35)42-12)41-19(11(13)32)30-5-26-9-16(30)27-20(22)28-17(9)33;;/h3-7,10-13,18-19,31-32H,1-2H2,(H,34,35)(H,36,37)(H2,21,23,24)(H3,22,27,28,33);;/q;2*+1/p-2/t6-,7?,10-,11-,12-,13-,18?,19-;;/m0./s1 |
| Inchi Key | MFPHQIYDBUVTRL-HBMYJXICSA-L |
| SMILES | [Na+].[Na+].NC1=NC2=C(N=CN2C2O[C@H]3CO[P@@]([O-])(=O)OC4C(COP([O-])(=O)OC3C2O)O[C@@H](C4O)N2C=NC3=C(N)N=CN=C23)C(=O)N1 |
| Size | 500 µg |
| Supplier Page | http://www.adipogen.com/ag-cr1-3588/cgamp.html |
