Amlexanox
Antiallergic. Anti-inflammatory. Antagonizes the angiogenic and mitogenic activity of FGF-1 through S100A13. Inhibits FGF-1 release. Binds to HSP90. Inhibits C-terminal chaperone activity. Induces an increase in nonsense-containing mRNAs amount in treated cells, leading to the synthesis of functional full-length proteins in an efficient manner. Selective inhibitor of TANK-binding Kinase 1 (TBK1) and IKKepsilon. Reversibly lowers weight and improves insulin sensitivity and reduces inflammation and attenuated hepatic steatosis in obese mices without affecting food intake.
| Catalog Number | AG-CR1-3579-M050 |
| Alternative Name(s) | 2-Amino-7-(1-methylethyl)-5-oxo-5H-[1]benzopyrano[2,3-b]pyridine-3-carboxylic acid; AA 673; Amoxanox; CHX 3673 |
| Research Area | Biochemicals, Cancer, Inflammation, Metabolism, Obesity |
| Molecular Formula | C16H14N2O4 |
| CAS# | 68302-57-8 |
| Purity | >98% |
| Inchi | InChI=1S/C16H14N2O4/c1-7(2)8-3-4-12-9(5-8)13(19)10-6-11(16(20)21)14(17)18-15(10)22-12/h3-7H,1-2H3,(H2,17,18)(H,20,21) |
| Inchi Key | SGRYPYWGNKJSDL-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(OC3=C(C=C(C(O)=O)C(N)=N3)C2=O)C=C1 |
| Size | 50 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-3579/amlexanox.html |
