Rosiglitazone . maleate
Same activities as rosaglitazone (Prod. No. AG-CR1-3570) but different formulation. Antidiabetic, hypoglycemic agent. Potent and selective peroxisome proliferator-activated receptor gamma (PPAR-gamma) agonist. Potent insulin sensitizing agent binding to the PPAR receptors in fat cells and making the cells more responsive to insulin. Ameliorates insulin resistance. Improves blood pressure and vascular function. Enhances proliferation of endogenous neural progenitor cells (NPCs). Anti-inflammatory compound. Has controversial therapeutic effects on the cardiovascular system. Promotes adipocyte differentiation of mesenchymal stem cells (MSCs).
| Catalog Number | AG-CR1-3571-G001 |
| Alternative Name(s) | BRL 49653C; Rosiglitazone XR; Avandia |
| Research Area | Biochemicals, Inflammation, Metabolism, Stem Cell Research |
| Molecular Formula | C18H19N3O3S . C4H4O4 |
| CAS# | 155141-29-0 |
| Purity | >98% |
| Inchi | InChI=1S/C18H19N3O3S.C4H4O4/c1-21(16-4-2-3-9-19-16)10-11-24-14-7-5-13(6-8-14)12-15-17(22)20-18(23)25-15;5-3(6)1-2-4(7)8/h2-9,15H,10-12H2,1H3,(H,20,22,23);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| Inchi Key | SUFUKZSWUHZXAV-BTJKTKAUSA-N |
| SMILES | OC(=O)C=C/C([O-])=O.C[NH+](CCOC1=CC=C(CC2SC(=O)NC2=O)C=C1)C1=CC=CC=N1 |
| Size | 1 g |
| Supplier Page | http://www.adipogen.com/ag-cr1-3571/rosiglitazone-maleate.html |
