1400W . dihydrochloride
A slow, tight binding and highly selective inhibitor of iNOS (inducible nitric oxide synthase/NOS II) (Kd < 7 nM). Weak and reversible inhibition of nNOS (neuronal nitric oxide synthase/NOS I) (Ki < 2) and eNOS (endothelial nitric oxide synthase/NOS III) (Ki < 50 µM). Inhibits tumor growth. Increases vasoconstriction to noradrenaline. Improves contractile function. Improves stroke outcome and decreases glutamate release. Anti-inflammatory. Review.
| Catalog Number | AG-CR1-0018-M005 |
| Alternative Name(s) | N-(3-(Aminomethyl)benzyl)acetamidine . 2HCl |
| Research Area | Biochemicals, Cancer, Inflammation |
| Molecular Formula | C10H15N3 . 2HCl |
| CAS# | 214358-33-5 |
| Purity | >98% |
| Inchi | InChI=1S/C10H15N3.2ClH/c1-8(12)13-7-10-4-2-3-9(5-10)6-11;;/h2-5H,6-7,11H2,1H3,(H2,12,13);2*1H |
| Inchi Key | WDJHSQZCZGPGAA-UHFFFAOYSA-N |
| SMILES | [Cl-].[Cl-].CC(=N)[NH2+]CC1=CC=CC(C[NH3+])=C1 |
| Size | 5 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-0018/1400w-dihydrochloride.html |
