Z-Leu-Leu-Leu-B(OH)2 [MG-262]
Highly potent and selective cell permeable inhibitor of the proteasome. Inhibits the chymotrypsin-like and caspase-like peptidase activity of the proteasome. Calpain and cathepsin inhibitor. Autophagy activator. Similar structure as MG-132 (AG-CP3-0011) but much higher potency.
| Catalog Number | AG-CP3-0024-M001 |
| Alternative Name(s) | Z-LLL-B(OH)2; Proteasome Inhibitor III |
| Research Area | Apoptosis, Autophagy, Biochemicals, Cancer, Cell Death, Immunology, Neurobiology |
| Molecular Formula | C25H42BN3O6 |
| CAS# | 179324-22-2 |
| Purity | >95% |
| Inchi | InChI=1S/C25H42BN3O6/c1-16(2)12-20(24(31)29-22(26(33)34)14-18(5)6)27-23(30)21(13-17(3)4)28-25(32)35-15-19-10-8-7-9-11-19/h7-11,16-18,20-22,33-34H,12-15H2,1-6H3,(H,27,30)(H,28,32)(H,29,31)/t20-,21-,22-/m0/s1 |
| Inchi Key | MWKOOGAFELWOCD-FKBYEOEOSA-N |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)OCC1=CC=CC=C1)B(O)O |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/ag-cp3-0024/z-leu-leu-leu-b-oh-2-mg-262.html |
