Z-VAD-FMK (Cell permeable)
Cell permeable, non-selective broad-spectrum caspase inhibitor. Binds irreversibly to the catalytic site of caspase proteases. The peptide is O-methylated in the P1 position on aspartic acid, providing enhanced stability and increased cell permeability. Inhibits ICE-family protease/caspase processing, leading to apoptosis and autophagy induction. Decreases proteasome activity. Potent inhibitor of caspase-1 activation in NLRP3/NALP3-induced cells. Used in apoptosis and inflammasome studies.
| Catalog Number | AG-CP3-0002-M001 |
| Alternative Name(s) | Z-VAD(OMe)-FMK; pan-Caspase Inhibitor; Z-Val-Ala-DL-Asp(OMe)-fluoromethylketone; Benzyloxycarbonyl-Val-Ala-DL-Asp(OMe)-fluoromethylketone |
| Research Area | Apoptosis, Autophagy, Biochemicals, Cancer, Cell Death, Inflammasomes, Inflammation, Necrosis, Neurodegenerative Disease |
| Molecular Formula | C22H30FN3O7 |
| CAS# | 187389-52-2 and 634911-81-2 |
| Purity | >95% |
| Inchi | InChI=1/C22H30FN3O7/c1-13(2)19(26-22(31)33-12-15-8-6-5-7-9-15)21(30)24-14(3)20(29)25-16(17(27)11-23)10-18(28)32-4/h5-9,13-14,16,19H,10-12H2,1-4H3,(H,24,30)(H,25,29)(H,26,31)/t14-,16?,19-/m0/s1 |
| Inchi Key | MIFGOLAMNLSLGH-SXUUOERCBK |
| SMILES | [H][C@](NC(=O)OCC1=CC=CC=C1)(C(C)C)C(=O)N[C@@H](C)C(=O)NC(CC(=O)OC)C(=O)CF |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/ag-cp3-0002/z-vad-fmk-cell-permeable.html |