Enniatin B
Cyclohexadepsipeptide mycotoxin. One of four major analogs in the enniatin complex. Commonly found food contaminant in cereals and their products. Ionophore antibiotic (less ionophoric than Enniatin A). Incorporation into the cell membrane forms dimeric structures that transport monovalent ions across the membrane (especially the mitochondrial membranes) affecting oxidative phosphorylation uncoupling. Anticancer compound. Triggers apoptosis in several cancer cell lines. Moderate inhibitor of ACAT (acylcoenzyme A:cholesterolacyl transferase). Inhibitor of the pleiotropic drug resistance protein 5 (Pdr5p) in yeast. Shown to have a variety of other biological activities such as antifungal, anthelmintic, insecticidal, immunomodulatory and phytotoxic activity.
| Catalog Number | AG-CN2-0479-M001 |
| Alternative Name(s) | Antibiotic 86/88 |
| Research Area | Antibiotic, Apoptosis, Biochemicals, Cancer, Immunology, Inflammation, Natural Products |
| Molecular Formula | C33H57N3O9 |
| CAS# | 917-13-5 |
| Purity | >98% |
| Inchi | InChI=1S/C33H57N3O9/c1-16(2)22-31(40)43-26(20(9)10)29(38)35(14)24(18(5)6)33(42)45-27(21(11)12)30(39)36(15)23(17(3)4)32(41)44-25(19(7)8)28(37)34(22)13/h16-27H,1-15H3/t22-,23-,24-,25+,26+,27+/m0/s1 |
| Inchi Key | MIZMDSVSLSIMSC-VYLWARHZSA-N |
| SMILES | CC(C)[C@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)[C@H](OC(=O)[C@H](C(C)C)N(C)C(=O)[C@H](OC(=O)[C@H](C(C)C)N(C)C1=O)C(C)C)C(C)C |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0479/enniatin-b.html |
