Betulin
Specific SREBPs (sterol regulatory element-binding proteins) inhibitor. Inhibits ER-Golgi translocation of SREBPs through binding to SCAP in an INSIG-dependent manner. Improves hyperlipidemia and insulin resistance and reduces atherosclerotic plaques. Lowers cholesterol levels through inhibition of SREBP-2 activation. Reduces weight gain and adipose tissue size in vivo. Increases oxygen consumption and energy expenditure. Increases UCP1/2 levels in brown adipose tissue (BAT) after cold stimulation. Anticancer compound. Apoptosis inducer. DNA topoisomerase II inhibitor. Anti-inflammatory compound. Shown to inhibit LPS-induced NO production through the TLR4/NF-kappaB signaling pathway. Antiviral compound.
| Catalog Number | AG-CN2-0476-G001 |
| Alternative Name(s) | Betulinol; Trochol; NSC 4644 |
| Research Area | Apoptosis, Biochemicals, Cancer, Inflammation, Metabolism, Natural Products, Obesity |
| Molecular Formula | C30H50O2 |
| CAS# | 473-98-3 |
| Purity | >98% |
| Inchi | InChI=1S/C30H50O2/c1-19(2)20-10-15-30(18-31)17-16-28(6)21(25(20)30)8-9-23-27(5)13-12-24(32)26(3,4)22(27)11-14-29(23,28)7/h20-25,31-32H,1,8-18H2,2-7H3/t20-,21+,22-,23+,24-,25+,27-,28+,29+,30+/m0/s1 |
| Inchi Key | FVWJYYTZTCVBKE-ROUWMTJPSA-N |
| SMILES | [H][C@]12[C@@H](CC[C@]1(CO)CC[C@]1(C)[C@]2([H])CC[C@]2([H])[C@@]3(C)CC[C@H](O)C(C)(C)[C@]3([H])CC[C@@]12C)C(C)=C |
| Size | 1 g |
| Supplier Page | http://www.adipogen.com/ag-cn2-0476/betulin.html |
