Mycophenolic acid
Antibiotic. Shows antiviral, antifungal and antitumor properties. Immunosuppressive drug used to prevent rejection in organ transplantation, rheumatoid arthritis, and psoriasis. Potent reversible inhibitor of inosine-5′-monophosphate dehydrogenase (IMPDH), leading to depletion of GMP and interruption of the de novo synthesis of purine nucleotides necessary for B and T lymphocyte proliferation. Inhibits the type II IMPDH isoform (IMPDH-2) 5-fold more potently compared to type I isoform. Inhibits RNA and DNA synthesis. Inducible nitric oxide synthase (iNOS/NOS II) inhibitor. Apoptosis and necrosis inducer. Novel type of inhibitor against RNA guanylyltransferases. Inhibits TNF-alpha-stimulated MAPK/NF-kappaB and ROS generation.
| Catalog Number | AG-CN2-0419-M100 |
| Alternative Name(s) | MPA; NSC 129185; Ly 68618; Mycophenolate |
| Research Area | Antibiotic, Cancer, Immunology, Inflammation, Natural Products |
| Molecular Formula | C17H20O6 |
| CAS# | 24280-93-1 |
| Purity | >98% |
| Inchi | InChI=1S/C17H20O6/c1-9(5-7-13(18)19)4-6-11-15(20)14-12(8-23-17(14)21)10(2)16(11)22-3/h4,20H,5-8H2,1-3H3,(H,18,19)/b9-4+ |
| Inchi Key | HPNSFSBZBAHARI-RUDMXATFSA-N |
| SMILES | COC1=C(C)C2=C(C(=O)OC2)C(O)=C1CC=C(/C)CCC(O)=O |
| Size | 100 mg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0419/mycophenolic-acid.html |
