Asiatic acid
Apoptosis inducer. Cell cycle arrest inducer. Anticancer compound Antioxidant. Hepatoprotective. Inhibits TGF-beta/Smad-mediated fibrogenesis. Stimulates wound healing. Anti-diabetic. Glycogen phosphorylase inhibitor. Neuroprotective. Modulates multiple targets associated with amyloid-beta precursor protein processing and amyloid-beta protein clearance. Down regulates BACE1 and increases ADAM10 maturation. Anti-hyperglycemic compound. Anti-inflammatory and antinociceptive compound. Antiangiogenic. Acetylcholinesterase (AChE) inhibitor. PPARgamma inhibitor through a C/EBPbeta-independent mechanisms. Anti-osteoporotic. Inhibits adipogenic differentiation of bone marrow stromal cells (BMSC).
| Catalog Number | AG-CN2-0400-M025 |
| Alternative Name(s) | 2alpha,23-Dihydroxyursolic acid; Dammarolic acid; NSC166063 |
| Research Area | Apoptosis, Biochemicals, Bone Research, Cancer, Cell Death, Inflammation, Metabolism, Natural Products, Neurodegenerative Disease |
| Molecular Formula | C30H48O5 |
| CAS# | 464-92-6 |
| Purity | >95% |
| Inchi | InChI=1S/C30H48O5/c1-17-9-12-30(25(34)35)14-13-28(5)19(23(30)18(17)2)7-8-22-26(3)15-20(32)24(33)27(4,16-31)21(26)10-11-29(22,28)6/h7,17-18,20-24,31-33H,8-16H2,1-6H3,(H,34,35)/t17-,18+,20-,21-,22-,23+,24+,26+,27+,28-,29-,30+/m1/s1 |
| Inchi Key | JXSVIVRDWWRQRT-UYDOISQJSA-N |
| SMILES | [H][C@@]12CC[C@]3(C)[C@]([H])(CC=C4[C@]5([H])[C@@H](C)[C@H](C)CC[C@@]5(CC[C@@]34C)C(O)=O)[C@@]1(C)C[C@@H](O)[C@H](O)[C@@]2(C)CO |
| Size | 25 mg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0400/asiatic-acid.html |
