K-252c
Indolocarbazole alkaloid antibiotic.. Potent cell permeable reversible and ATP-competitive PKC (protein kinase C) inhibitor with 10-fold selectivity over PKA (protein kinase A). Anticancer compound. Cytotoxic againt various cancer cell lines. Apoptosis inducer. Antiviral compound against GCV-sensitive and -resistant strains of human cytomegalovirus (HCMV). LACTB (beta-lactamase), malate dehydrogenase (MDH2, MDHC, MDH1B, ME1. ME2, ME3) and chymotrypsin inhibitor. Inhibits mixed lineage kinase (MLK).
| Catalog Number | AG-CN2-0097-M001 |
| Alternative Name(s) | Staurosporine aglycone; Staurosporinone; Antibiotic K252c; 6,7,12,13-Tetrahydro-5H-indolo[2,3-a]pyrrolo[3,4-c]carbazol-5-one |
| Research Area | Antibiotic, Apoptosis, Cancer, Cell Death, Inflammation, Natural Products |
| Molecular Formula | C20H13N3O |
| CAS# | 85753-43-1 |
| Purity | >97% |
| Inchi | InChI=1S/C20H13N3O/c24-20-17-12(9-21-20)15-10-5-1-3-7-13(10)22-18(15)19-16(17)11-6-2-4-8-14(11)23-19/h1-8,22-23H,9H2,(H,21,24) |
| Inchi Key | MEXUTNIFSHFQRG-UHFFFAOYSA-N |
| SMILES | O=C1NCC2=C1C1=C(NC3=C1C=CC=C3)C1=C2C2=C(N1)C=CC=C2 |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0097/k-252c.html |
