Heliquinomycin
Antibiotic. DNA helicase inhibitor. Inhibits the DNA helicase activity of the human minichromosome maintenance (MCM) 4/6/7 complex. Topoisomerase I and II inhibitor (weaker than DNA helicase). DNA and RNA synthesis inhibitor in cell culture. Does not inhibit protein synthesis. Induces cell cycle arrest. Anticancer compound. Antibacterial against Gram-positive bacteria.
| Catalog Number | AG-CN2-0091-C250 |
| Alternative Name(s) | Rubymycin; NSC 702208 |
| Research Area | Antibiotic, Cancer, Natural Products |
| Molecular Formula | C33H30O17 |
| CAS# | 178182-49-5 |
| Purity | >80% |
| Inchi | InChI=1S/C33H30O17/c1-10-23(36)15(44-3)9-18(46-10)48-30-22-25(38)20-13(34)8-14(43-2)24(37)21(20)27(40)29(22)50-33(30)17(35)7-12-5-11-6-16(31(41)45-4)47-32(42)19(11)26(39)28(12)49-33/h5-6,8,10,15,17-18,23,30,35-36,38-40H,7,9H2,1-4H3/t10?,15?,17-,18?,23?,30-,33-/m1/s1 |
| Inchi Key | MLFZQFHGXSVTGX-VJANPNJTSA-N |
| SMILES | COC1CC(O[C@@H]2C3=C(O[C@@]22OC4=C(C[C@H]2O)C=C2C=C(OC(=O)C2=C4O)C(=O)OC)C(O)=C2C(=O)C(OC)=CC(=O)C2=C3O)OC(C)C1O |
| Size | 250 µg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0091/heliquinomycin.html |
