Stevioside hydrate
Noncaloric natural sweetener, 300 times more potent than sucrose. Antidiabetic. Antihyperglycaemic and antihypoglycaemic. Potentiates insulin secretion. Enhances acetyl-CoA carboxylase (ACC) gene expression. Increases insulin sensitivity.. Antihypertensive. Ca2+ influx inhibitor. Anticancer compound. Chemopreventive. Anti-inflammatory. IKKbeta, NF-kappaB and MAPK signaling inhibitor. Induces TNF-alpha, IL-1beta and nitric oxide release. Immunomodulator. Increasees phagocytic activity, haemagglutination antibody titre, delayed type hypersensitivity. Increased proliferation in LPS and Con A stimulated B and T cells. Peripheral µ-opioid receptors activator. Important for regulation of glucose homeostasis. Anti-atherosclerotic. Review.
| Catalog Number | AG-CN2-0077-M050 |
| Alternative Name(s) | BRN 0077427; CCRIS 6116 |
| Research Area | Cancer, Inflammation, Metabolism, Natural Products, Obesity |
| Molecular Formula | C38H60O18 . xH2O |
| CAS# | 57817-89-7 (anhydrous) |
| Purity | >95% |
| Inchi | InChI=1S/C38H60O18/c1-16-11-37-9-5-20-35(2,7-4-8-36(20,3)34(50)55-32-29(49)26(46)23(43)18(13-40)52-32)21(37)6-10-38(16,15-37)56-33-30(27(47)24(44)19(14-41)53-33)54-31-28(48)25(45)22(42)17(12-39)51-31/h17-33,39-49H,1,4-15H2,2-3H3/t17-,18-,19-,20+,21+,22-,23-,24-,25+,26+,27+,28-,29-,30-,31+,32+,33?,35-,36-,37-,38+/m1/s1 |
| Inchi Key | UEDUENGHJMELGK-ZBVPAOMMSA-N |
| SMILES | [H][C@@]12CC[C@@]3(C[C@]1(CC3=C)CC[C@]1([H])[C@@](C)(CCC[C@@]21C)C(=O)O[C@@H]1OC(CO)[C@@H](O)[C@@H](O)C1O)O[C@@H]1OC(CO)[C@@H](O)[C@@H](O)C1O[C@@H]1OC(CO)[C@@H](O)[C@@H](O)C1O |
| Size | 50 mg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0077/stevioside-hydrate.html |
