Wogonin
Anti-inflammatory. Increases nitric oxide (NO) production. Inhibits PGE2, cyclooxygenase-2 (COX-2) and inducible nitric oxide synthase (iNOS; NOS II). Antioxidant. Anti-viral. Shows anti-hepatitis B virus activity. MCP-1 inhibitor. Shows anxiolytic effect through modulation of the GABA(A) receptor complex. Antifungal. Neuroprotective. Anticancer compound. Apoptosis and cell cycle arrest inducer. Sensitizes TNFalpha- and TRAIL-induced apoptosis. Antiangiogenic. NF-kappaB inhibitor. Telomerase activity inhibitor. CDK9 inhibitor. PI3K-AKT pathway modulator. Autophagy inducer.
| Catalog Number | AG-CN2-0064-M025 |
| Alternative Name(s) | WOG; 5,7-Dihydroxy-8-methoxyflavone; BRN 0287152 |
| Research Area | Apoptosis, Autophagy, Cancer, Cell Death, Immunology, Inflammation, Natural Products, Neurobiology |
| Molecular Formula | C16H12O5 |
| CAS# | 632-85-9 |
| Purity | >98% |
| Inchi | InChI=1S/C16H12O5/c1-20-15-12(19)7-10(17)14-11(18)8-13(21-16(14)15)9-5-3-2-4-6-9/h2-8,17,19H,1H3 |
| Inchi Key | XLTFNNCXVBYBSX-UHFFFAOYSA-N |
| SMILES | COC1=C(O)C=C(O)C2=C1OC(=CC2=O)C1=CC=CC=C1 |
| Size | 25 mg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0064/wogonin.html |
