FK-506
Potent immunosuppressant (as cyclosporin A and rapamycin). Suppresses proliferation of cytotoxic T cells and inhibits the production of T cell-derived mediators such as interleukin-2 (IL-2). Forms a complex with FK-506 binding protein 12 (FKBP12). Inhibits the activity of the calcium/calmodulin-dependent protein phosphatase 2B (PP2B; calcineurin), leading to disruption of T cell activation. Prevents rejection of transplanted organs. Anti-inflammatory compound in the treatment of several inflammatory skin diseases (e.g. atopic dermatitis) and with potential anti-rheumatic activity (rheumatoid arthritis). Neuroprotective. Regulates nitric oxide neurotoxicity. Neurotransmitter. Ca2+ release compound. NF-kappaB suppressor by induction of unfolded protein response (UPR). Anti-cancer compound. Apoptosis inducer.
| Catalog Number | AG-CN2-0047-M025 |
| Alternative Name(s) | Tacrolimus; Fujimycin |
| Research Area | Immunology, Inflammation, Natural Products, Neurobiology, Neurodegenerative Disease |
| Molecular Formula | C44H69NO12 . H2O |
| CAS# | 109581-93-3 |
| Purity | >98% |
| Inchi | InChI=1S/C44H69NO12.H2O/c1-10-13-31-19-25(2)18-26(3)20-37(54-8)40-38(55-9)22-28(5)44(52,57-40)41(49)42(50)45-17-12-11-14-32(45)43(51)56-39(29(6)34(47)24-35(31)48)27(4)21-30-15-16-33(46)36(23-30)53-7;/h10,19,21,26,28-34,36-40,46-47,52H,1,11-18,20,22-24H2,2-9H3;1H2/b25-19+,27-21+;/t26-,28+,29+,30-,31+,32?,33+,34?,36+,37-,38-,39+,40+,44+;/m0./s1 |
| Inchi Key | NWJQLQGQZSIBAF-CBLXODBSSA-N |
| SMILES | [H]O[H].[H][C@]1(CC[C@@]([H])(O)[C@@]([H])(C1)OC)C=C(/C)[C@@]1([H])OC(=O)C2CCCCN2C(=O)C(=O)[C@]2(O)O[C@@]([H])([C@H](C[C@@]2([H])C)OC)[C@]([H])(C[C@@]([H])(C)CC(C)=C[C@@]([H])(CC=C)C(=O)CC(O)[C@@]1([H])C)OC |
| Size | 25 mg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0047/fk506.html |
