Kaempferitrin
Cytotoxic and anti-inflammatory compound (weak). Antioxidant. Lipid peroxidation inhibitor. Free radical scavenger. Inhibitor of myeloperoxidase activity. Hypoglycemic. Decreases blood glucose levels in diabetic and normal rats. Insulinomimetic. Modulates glucose homeostasis. Decreases blood glucose levels and stimulates glucose uptake in muscle. Inhibits GLUT4 mediated glucose uptake in differentiated 3T3-L1 cells. Improves insulin resistance by the activation of the classical insulin transduction pathway. Increases adiponectin secretion in 3T3-L1 adipocytes. Antinoniceptive. May have antidyslipidemic activity.
| Catalog Number | AG-CN2-0039-M005 |
| Alternative Name(s) | Lespenefril; Lespedin; BRN 0073958; Kaempferol 3,7-dirhamnoside |
| Research Area | Immunology, Inflammation, Metabolism, Natural Products |
| Molecular Formula | C27H30O14 |
| CAS# | 482-38-2 |
| Purity | >98% |
| Inchi | InChI=1S/C27H30O14/c1-9-17(30)20(33)22(35)26(37-9)39-13-7-14(29)16-15(8-13)40-24(11-3-5-12(28)6-4-11)25(19(16)32)41-27-23(36)21(34)18(31)10(2)38-27/h3-10,17-18,20-23,26-31,33-36H,1-2H3/t9-,10-,17-,18-,20+,21+,22+,23+,26-,27-/m0/s1 |
| Inchi Key | PUPKKEQDLNREIM-QNSQPKOQSA-N |
| SMILES | O=C1C2=C(O)C=C(O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)C=C2OC(C4=CC=C(O)C=C4)=C1O[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O |
| Size | 5 mg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0039/kaempferitrin.html |
