Nigericin . sodium salt
Antibiotic. High affinity ionophore for monovalent cations such as H+, K+, Na+, Pb2+. Shows antibacterial (Gram-positive), antifungal, antitumor and antiviral activity. Disrupts membrane potential of mitochondria. NLRP3/NALP3 activator. Signals through pannexin-1 to induce caspase-1 maturation and IL-1beta processing and release. Autophagy modulator
| Catalog Number | AG-CN2-0020-M025 |
| Alternative Name(s) | Antibiotic K 178; Helexin C; Polyetherin A; BRN 1696755; Azalomycin M; Antibiotic X-464 |
| Research Area | Antibiotic, Cancer, Inflammasomes, Inflammation, Metabolism, Natural Products, Neurobiology |
| Molecular Formula | C40H67O11 . Na |
| CAS# | 28643-80-3 |
| Purity | >98% |
| Inchi | 1S/C40H68O11.Na/c1-21-11-12-28(46-33(21)26(6)36(42)43)17-29-18-30(45-10)27(7)40(48-29)25(5)19-38(9,51-40)32-13-14-37(8,49-32)35-23(3)16-31(47-35)34-22(2)15-24(4)39(44,20-41)50-34;/h21-35,41,44H,11-20H2,1-10H3,(H,42,43);/q;+1/p-1/t21-,22-,23-,24+,25+,26+,27+,28+,29+,30+,31+,32+,33+,34-,35+,37-,38-,39-,40+;/m0./s1 |
| Inchi Key | MOYOTUKECQMGHE-PDEFJWSRSA-M |
| SMILES | [Na+].[H][C@@]1(C[C@H](C)[C@@]([H])(O1)[C@]1(C)CC[C@@]([H])(O1)[C@]1(C)C[C@@H](C)[C@]2(O1)O[C@H](C[C@@]1([H])CC[C@H](C)[C@@]([H])(O1)[C@@H](C)C([O-])=O)C[C@@H](OC)[C@H]2C)[C@@]1([H])O[C@@](O)(CO)[C@H](C)C[C@@H]1C |
| Size | 25 mg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0020/nigericin-sodium-salt.html |
