X-Gal
Molecular biology reagent. Chromogenic substrate for beta-galactosidase. Used in gene cloning together with IPTG (Prod. No. AG-CC1-0002) to indicate whether a cell expresses the beta-galactosidase enzyme, which is encoded by the lacZ gene, in a technique called blue/white screening. Distinguishes between recombinant and non-recombinant plasmids carrying the beta-galactosidase gene. Used in two-hybrid analysis. X-Gal is used to determine E. coli and coliform content in drinking water samples.
| Catalog Number | AG-CC1-0003-M250 |
| Alternative Name(s) | 5-Bromo-4-chloro-3-indolyl beta-D-galactoside |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C14H15BrClNO6 |
| CAS# | 7240-90-6 |
| Purity | >99% |
| Inchi | InChI=1S/C14H15BrClNO6/c15-5-1-2-6-9(10(5)16)7(3-17-6)22-14-13(21)12(20)11(19)8(4-18)23-14/h1-3,8,11-14,17-21H,4H2/t8?,11-,12-,13+,14+/m0/s1 |
| Inchi Key | OPIFSICVWOWJMJ-LMNFNBGQSA-N |
| SMILES | OCC1O[C@@H](OC2=CNC3=C2C(Cl)=C(Br)C=C3)C(O)[C@H](O)[C@H]1O |
| Size | 250 mg |
| Supplier Page | http://www.adipogen.com/ag-cc1-0003/x-gal.html |