IPTG (animal-free, dioxane-free)
Molecular biology reagent. beta-Galactosidase activity inducer in several bacteria, by binding and inhibiting the lac repressor. Used in gene cloning together with X-Gal (Prod. No. AG-CC1-0003), in a technique called blue/white screening. Distinguishes between recombinant and non-recombinant plasmids carrying the beta-galactosidase gene. Plant origin, contains no animal-derived contaminants. Stimulates beta-galactosidase in cellular systems in which dioxane would disrupt normal cell function.
| Catalog Number | AG-CC1-0002-G025 |
| Alternative Name(s) | Isopropyl-beta-D-thiogalactoside |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C9H18O5S |
| CAS# | 367-93-1 |
| Purity | >99% |
| Inchi | InChI=1S/C9H18O5S/c1-4(2)15-9-8(13)7(12)6(11)5(3-10)14-9/h4-13H,3H2,1-2H3/t5?,6-,7-,8+,9-/m0/s1 |
| Inchi Key | BPHPUYQFMNQIOC-IVORRVBJSA-N |
| SMILES | CC(C)S[C@@H]1OC(CO)[C@H](O)[C@@H](O)C1O |
| Size | 25 g |
| Supplier Page | http://www.adipogen.com/ag-cc1-0002/iptg-animal-free-dioxane-free.html |
