Cyclotraxin B acetate(1203586-72-4 free base)
Cyclotraxin B acetate is an antagonist of TrkB receptors; inhibits BDNF-induced TrkB activity (IC50 = 0.30 nM). Allosterically alters TrkB receptor conformation but does not alter BDNF binding. Prevents BDNF-induced cold allodynia in mice. Also shown to exhibit putative anxiolytic properties in mice.
| Catalog Number | TP2068L |
| Research Area | Tyrosine Kinase/Adaptors |
| Molecular Formula | C50H77N13O19S3 |
| CAS# | TP2068L |
| Purity | 99.42% |
| SMILES | C[C@@H](O)[C@H]1C(N[C@@H](CCCCN)C(N[C@@H](CCC(O)=O)C(NCC(N[C@H](C(O)=O)CSSC[C@H](N)C(N[C@@H](CC(N)=O)C(N2CCC[C@H]2C(N[C@@H](CCSC)C(NCC(N[C@@H](CC3=CC=C(O)C=C3)C(N1)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O.O=C(C)O |
| Size | 50 mg |
| Supplier Page | https://www.targetmol.com/compound/Cyclotraxin B acetate(1203586-72-4 free base) |
| Additional Information | https://www.targetmol.com/datasheet/TP2068L |