(+)-Biotin-PEG6-hydrazide
(+)-Biotin-PEG6-hydrazide is a polyethylene glycol (PEG) derived linker, specifically designed for the synthesis of proteolysis-targeting chimeras (PROTACs)[1].
| Catalog Number | T18550 |
| Research Area | Others |
| Molecular Formula | C25H47N5O9S |
| CAS# | T18550 |
| SMILES | O=C(NCCOCCOCCOCCOCCOCCOCCC(NN)=O)CCCC[C@@H]1SC[C@]([C@]1([H])N2)([H])NC2=O |
| Size | 500 mg |
| Supplier Page | https://www.targetmol.com/compound/(+)-Biotin-PEG6-hydrazide |
| Additional Information | https://www.targetmol.com/datasheet/T18550 |
