Yam Extract
Yam Extract is extracted from yam (Chinese yam), the rhizome of various species of genus Dioscorea opposita Thunb. (Dioscoreaceae). Yam contains mainly proteins, sugars, vitamins, fats, choline, amylase, iodine, iron, calcium, phosphorus, and other indispensable trace elements in the human body. The main pharmacological effects of yam are antioxidative, anti-aging, anti-tumor, and hypoglycemic. Yam also can enhance immunity.
| Trivial name | Chinese yam Extract, Dioscoreae rhizoma Extract |
| Catalog Number | E3618 |
| Molecular Formula | C19H15NO2 |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)C(=O)C=CC3=CN=CC=C3 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/yam-extract.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e3618-chemical-structure-tube.png |
