Hovenia Dulcis Fruit Extract
Hovenia Dulcis Fruit Extract is extracted from the fruits of Hovenia dulcis, which has functions such as liver protection and detoxification from alcohol poisoning.
| Trivial name | Hovenia Acerba Extract, Honey Tree Fruit Extract |
| Catalog Number | E3872 |
| Molecular Formula | C16H10F2N6O |
| SMILES | C1=CC=C(C(=C1)NC2=NC3=NON=C3N=C2NC4=CC=CC=C4F)F |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/hovenia-dulcis-fruit-extract.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E3872-chemical-structure-tube.png |