DNA Damage/DNA Repair compound Library
A unique collection of 844 small molecules used for DNA Damage and Repair research with targeting PARP,ATM/ATR,Topoisomerase,DNA/RNA Synthesis etc.
| Catalog Number | L4600 |
| Molecular Formula | C10H14O |
| Inchi | InChI=1S/C10H14O/c1-8(2)10-5-3-9(7-11)4-6-10/h3-6,8,11H,7H2,1-2H3 |
| Inchi Key | OIGWAXDAPKFNCQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)CO |
| Size | 100uL/well |
| Supplier Page | http://www.selleckchem.com/screening/dna-damage-and-repair-compound-library.html |
