Theaflavin
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-02536 |
| Alternative Name(s) | 3,4,6-trihydroxy-1,8-bis((2R,3R)-3,5,7-trihydroxychroman-2-yl)-5H-benzo[7]annulen-5-one |
| Research Area | Theaflavins is a class of natural flavonoids derived from the dried leaves of the plant Camellia sinensis (tea) and related plants with potent antioxidant properties. Theaflavins are polymers derived from natural catechins which are oxidized upon drying o |
| Molecular Formula | C29H24O12 |
| CAS# | NULL |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC1=C(C2=O)C(C=C([C@H]3OC4=CC(O)=CC(O)=C4C[C@H]3O)C=C2O)=C([C@H]5OC6=CC(O)=CC(O)=C6C[C@H]5O)C=C1O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02536.html |
| Additional Information | NULL |