O-Fluoroaniline isomer of Ezetimibe
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-14869 |
| Alternative Name(s) | (3R,4S)-1-(2-fluorophenyl)-3-((S)-3-(4-fluorophenyl)-3-hydroxypropyl)-4-(4-hydroxyphenyl)azetidin-2-one |
| Research Area | Impurity in commercial preparation of Ezetimibe. |
| Molecular Formula | C24H21F2NO3 |
| CAS# | NULL |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H](CC[C@@H]1[C@H](N(C1=O)C2=C(C=CC=C2)F)C3=CC=C(C=C3)O)C4=CC=C(C=C4)F |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO14869.html |
| Additional Information | NULL |