Methylprednisolone Sodium Succinate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-31166 |
| Alternative Name(s) | NULL |
| Research Area | 6α-Methylprednisolone 21-Hemisuccinate is a glucocorticosteroid used in anti-inflammatory medication in the treatment of spinal cord injuries. |
| Molecular Formula | C26H33O8.Na |
| CAS# | NULL |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1([C@@]2(O)C(COC(CCC([O-])=O)=O)=O)[C@](CC2)([H])[C@@](C[C@H](C)C3=CC4=O)([H])[C@]([C@]3(C=C4)C)([H])[C@@H](O)C1.[Na+] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO31166.html |
| Additional Information | NULL |