Levothyroxine D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-16186 |
| Alternative Name(s) | (2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodo(2,6-D2)phenyl](2-D)propanoic acid |
| Research Area | Labeled Levothyroxine, intended for use as an internal standard for the quantification of Levothyroxine by GC- or LC-mass spectrometry. |
| Molecular Formula | C15H8D3I4NO4 |
| CAS# | NULL |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | IC1=C(C(I)=C([2H])C(C[C@@](N)([2H])C(O)=O)=C1[2H])OC2=CC(I)=C(O)C(I)=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16186.html |
| Additional Information | NULL |