Hesperetin D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06658 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Hesperetin, Hesperetin Stable isotope;Labeled Hesperetin, intended for use as an internal standard for the quantification of Hesperetin by GC- or LC-mass spectrometry. |
| Molecular Formula | C16H11D3O6 |
| CAS# | NULL |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C[C@@H](C1=CC(O)=C(OC([2H])([2H])[2H])C=C1)OC2=CC(O)=C3)C2=C3O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06658.html |
| Additional Information | NULL |