Fenspiride Hydrochloride
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-10842 |
| Alternative Name(s) | 8-phenethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one hydrochloride;Decaspiride; Fluiden; Pneumorel; Fenspiride HCl. |
| Research Area | Bronchodilator with anti-inflammatory properties. Inhibits mucus secretion and reduces the release of tachykinins at a prejunctional level by its anti-muscarinic action. It also may be an antagonist at a adrenergic and H1 histamine receptors. |
| Molecular Formula | C15H21ClN2O2 |
| CAS# | NULL |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1OC2(CCN(CCC3=CC=CC=C3)CC2)CN1.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10842.html |
| Additional Information | NULL |