Carpipramine Dihydrochloride
API Standards
| Trivial name | NULL |
| Catalog Number | CS-T-50393 |
| Alternative Name(s) | 1'-[3-(10,11-Dihydro-5H-dibenz[b,f]azepin-5-yl)propyl]-[1,4'-bipiperidine]-DPZ 1511; |
| Research Area | Carpipramine Dihydrochloride, is an atypical antipsychotic used for the treatment of schizophrenia and anxiety. It is structurally related to Imipramine . |
| Molecular Formula | C28H40Cl2N4O |
| CAS# | NULL |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC(C1(N2CCCCC2)CCN(CCCN3C4=CC=CC=C4CCC5=C3C=CC=C5)CC1)=O.Cl.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST50393.html |
| Additional Information | NULL |