Cabergoline N-Oxide
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-P-03535 |
| Alternative Name(s) | 3-((6aR,9R,10aR)-7-allyl-N-(ethylcarbamoyl)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-9-carboxamido)-N,N-dimethylpropan-1-amine oxide |
| Research Area | The N-oxide of Cabergoline , a dopamine D2-receptor agonist. |
| Molecular Formula | C26H37N5O3 |
| CAS# | NULL |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C=CCN(C[C@H](C(N(CCC[N+](C)([O-])C)C(NCC)=O)=O)C1)[C@@](C2)([H])[C@@]1([H])C3=C4C2=CNC4=CC=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSP03535.html |
| Additional Information | NULL |