8-Methoxy Entecavir
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-16042 |
| Alternative Name(s) | 2-Amino-9-((1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylenecyclopentyl)-8-methoxy-1H-purin-6(9H)-one; Entecavir EP Impurity E |
| Research Area | 8-Methoxy Entecavir is an impurity of Entecavir (E558900), an oral antiviral drug used in the treatment of hepatitis B infection. A guanine analogue that inhhibits all three steps in the viral replication process. |
| Molecular Formula | C13H17N5O4 |
| CAS# | NULL |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C=C([C@@H]1CO)[C@H](C[C@@H]1O)N2C(NC(N)=NC3=O)=C3N=C2OC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16042.html |
| Additional Information | NULL |