8-Hydroxy Entecavir
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-16045 |
| Alternative Name(s) | 2-amino-9-((1R,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylenecyclopentyl)-1H-purine-6,8(7H,9H)-dione; 8-Hydroxy Entecavir; Entecavir EP Impurity C |
| Research Area | 8-Hydroxy Entecavir is an impurity of Entecavir, an oral antiviral drug used in the treatment of hepatitis B infection. |
| Molecular Formula | C12H15N5O4 |
| CAS# | NULL |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C=C([C@@H]1CO)[C@H](C[C@@H]1O)N2C(NC(N)=NC3=O)=C3NC2=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16045.html |
| Additional Information | NULL |
