Raf265 derivative 5mg
Raf265 derivative is a derivative of Raf265 that is an oral, highly selective RAF and VEGFR kinase inhibitor with IC50 of of 5 to 10 ??M.
| Trivial name | Raf265 derivative 5mg |
| Catalog Number | A10774-5 |
| Alternative Name(s) | N/A |
| Molecular Formula | C23H14F6N6O |
| CAS# | N/A |
| SMILES | C1=CC(=CC=C1C(F)(F)F)NC2=NC3=C(N2)C=C(C=C3)OC4=CC(=NC=C4)C5=NC=C(N5)C(F)(F)F |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/raf265-derivative.html |
