ZY-2 | MedChemExpress (MCE)
ZY-2 is a specific fluorescent probe for pyruvate kinase M2 (PKM2). ZY-2 can image in PKM2-positive cells in a time- and concentration-dependent manner. ZY-2 can be used for the detection of cancer cells[1].
| Trivial name | ZY-2 |
| Catalog Number | HY-D1876 |
| Research Area | Cancer |
| Purity | ≥98.00% |
| SMILES | CN1C2=C(SC(S(C)=O)=C2)C3=C1C(N(N=C3)CC4=CC(NC(CN5CCN(C6=CC=C(C=C6)/C=C/C7=CC=[N+](CC)C=C7)CC5)=O)=CC=C4)=O.[O-]C(C(F)(F)F)=O |
| PubChem Chemical Structure ID | 168679636 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zy-2.html |