ZMF-23 | MedChemExpress (MCE)
ZMF-23 is a PAK1/HDAC6 dual inhibitor. ZMF-23 inhibits PAK1 and HDAC6 regulated aerobic glycolysis and migration. ZMF-23 induces TNF-α-regulated necroptosis, and further enhances apoptosis. ZMF-23 inhibits the Warburg effect and cell migration. ZMF-23 can be used for research of triple-negative breast cancer (TNBC)[1].
| Trivial name | ZMF-23 |
| Catalog Number | HY-155179 |
| Research Area | Cancer |
| Purity | ≥98.00% |
| SMILES | ClC1=CC(Cl)=CC=C1C2=CC3=CN=C(NC4CC4)N=C3N(CCCCCC(NO)=O)C2=O |
| PubChem Chemical Structure ID | 168510343 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zmf-23.html |