ZG36 | MedChemExpress (MCE)
ZG36 is a human Caseinolytic protease P (ClpP) agonist. ZG36 non-selectively degrades respiratory chain complexes and reduces mitochondrial DNA, ultimately leading to mitochondrial dysfunction and leukemic cell death. ZG36 also inhibits the development of acute myeloid leukemia in a xenograft mouse model[1].
| Trivial name | ZG36 |
| Catalog Number | HY-155556 |
| Research Area | Cancer |
| Purity | ≥98.00% |
| SMILES | BrC1=CC=C(CNC(N(CC2)[C@]3([H])N([C@H](C(N(C3)CC4=C5C(C=CC=C5)=C(OC)C=C4)=O)[C@H](CC)C)C2=O)=O)C=C1 |
| PubChem Chemical Structure ID | 168476045 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zg36.html |