YCH2823 | MedChemExpress (MCE)
YCH2823 is an inhibitor of USP7 (IC50 = 49.6 nM; Kd = 0.117 μM). YCH2823 shows significant efficacy in inhibiting TP53 wild-type and mutant tumors, with approximately 5-fold higher potency than FT671. YCH2823 induce apoptosis. YCH2823 synergistic effects with mTOR inhibitors[1].
| Trivial name | YCH2823 |
| Catalog Number | HY-158039 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | COC1=CC=C(C=C1)N2C=CC3=C2N=CN(C3=O)CC4(CCN(CC4)C(C[C@H](C5=CC=CC=C5)C)=O)O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ych2823.html |
