WD6305 TFA | MedChemExpress (MCE)
WD6305 TFA is a potent METTL3-targeted PROTAC degrader. WD6305 TFA selectively reduces the METTL3 and METTL14 complex. WD6305 TFA inhibits m6A modification and the proliferation of AML cells and promotes apoptosis. WD6305 TFA can be used for the research of leukemic[1].
| Trivial name | WD6305 TFA |
| Catalog Number | HY-160415A |
| Research Area | Cancer |
| Purity | 98.5% |
| SMILES | O=C(N[C@@H](C(C)(C)C)C(N1[C@H](C(N[C@@H](C)C2=CC=C(C3=C(C)N=CS3)C=C2)=O)C[C@@H](O)C1)=O)CCC#CC(C=C4)=CC=C4CNC5=CC(N(CC6)CCC76NC(CN(C8=CC(F)=C(CN9CCC(C)(C)CC9)C=C8F)C7)=O)=NC=N5.O=C(O)C(F)(F)F |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/wd6305-tfa.html |