WB518 | MedChemExpress (MCE)
WB518 is a potent STAT3 inhibitor. WB518 effectively inhibits STAT3 activation and Keratin 17 expression. WB518 effectively alleviates imiquimod (HY-B0180) and TPA (HY-18739)-induced animal psoriasis by inhibiting STAT3 phosphorylation and Keratin 17[1].
| Trivial name | WB518 |
| Catalog Number | HY-163176 |
| Research Area | Inflammation/Immunology |
| Purity | ≥98.0% |
| SMILES | COC(C1CN(CC2=C1C(C#N)=C(S2)NC(C3=CN(N=C3)C)=O)C(C4=CC=C(O4)Br)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/wb518.html |