Vilazodone-d8 hydrochloride | MedChemExpress (MCE)
Vilazodone-d8 hydrochloride is deuterated labeled Vilazodone (HY-14262). Vilazodone (EMD 68843; SB 659746A) is a potent, selective and orally active?serotonin?reuptake inhibitor (SSRI) and partial?5-HT1A receptor agonist. Vilazodone exhibits antidepressant efficacy in vivo can be used for the research of major depressive disorder (MDD) and affective disorders[1][2].
| Trivial name | Vilazodone-d8 hydrochloride |
| Catalog Number | HY-14262S1 |
| Alternative Name(s) | EMD 68843-d8; SB659746A-d8 |
| Research Area | Neurological Disease |
| Purity | ≥98.0% |
| SMILES | NC(C1=CC2=C(C=CC(N3CCN(C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C4=CNC5=CC=C(C=C54)C#N)CC3)=C2)O1)=O.Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/vilazodone-d8-hydrochloride.html |