TNIK-IN-9 | MedChemExpress (MCE)
TNIK-IN-9 (Compound 54) is a selective and potent NIK inhibitor, with an IC50 of 1.27 nM. TNIK-IN-9 can inhibit pro-inflammatory cytokines and nitric oxide production. TNIK-IN-9 exhibits significant anti-inflammatory effects, improved mortality, and hepatoprotective effects in sepsis models[1].
| Trivial name | TNIK-IN-9 |
| Catalog Number | HY-163478 |
| Research Area | Inflammation/Immunology |
| Purity | ≥98.0% |
| SMILES | O[C@@](C1=NC=CS1)(C#CC2=NN3C(N(CCC3)C4=CC=NC(NC5=CC6=C(C=C5)OCO6)=N4)=C2)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/tnik-in-9.html |