TH6342 | MedChemExpress (MCE)
TH6342 is a SAMHD1 modulator that binds to pretetrameric SAMHD1 and prevents its oligomerization and allosteric activation. SAMHD1 is a dNTP triphosphohydrolase and an HIV-1 restriction factor. SAMHD1 can limit the replication of retroviruses and DNA viruses and has antiviral effects. The inhibitory mechanism of TH6342 does not occupy the SAMHD1 nucleotide-binding pocket, gently binds the target, and functions as a chemical probe[1].
| Trivial name | TH6342 |
| Catalog Number | HY-161296 |
| Research Area | Infection |
| Purity | 98.9% |
| SMILES | ClC(C=CC=C1)=C1C(N=C2NCCC3=NC=CC=C3)=CN4C2=NC=C4 |
| Size | 10 mg |
| Supplier Page | https://www.medchemexpress.com/th6342.html |
