TAM557 TFA | MedChemExpress (MCE)
TAM557 TFA is a cytotoxic tubulysin compounds, which is modified to be used for conjugation to transport vehicles that are targeting molecules, such as proteins, peptides, small molecules or polymeric carriers which can carry a targeting principle[1].
Trivial name | TAM557 TFA |
Catalog Number | HY-160473A |
Research Area | Cancer |
Purity | 98.5% |
SMILES | O=C([C@@H]1N(CCCC1)C)N[C@@H]([C@@H](C)CC)C(N(CCC)[C@@H](C(C)C)C[C@H](C2=NC(C(N[C@H](C[C@H](C)C(NNC(OCCOCCOCCOCCN)=O)=O)CC3=CC=C(C=C3)O)=O)=CS2)OCCC)=O.O=C(O)C(F)(F)F |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/tam557-tfa.html |